C24H31FO3S — CID 57342651
tert-butyl (3S)-3-[(R)-fluoro-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]methyl]hexanoate (PubChem CID 57342651) has the molecular formula C24H31FO3S and a molecular weight of 418.57 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(R)-fluoro-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]methyl]hexanoate.
| Compound Name | tert-butyl (3S)-3-[(R)-fluoro-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]methyl]hexanoate |
|---|---|
| PubChem CID | 57342651 |
| Molecular Formula | C24H31FO3S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl (3S)-3-[(R)-fluoro-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]methyl]hexanoate |
| SMILES | CCC[C@@H](CC(=O)OC(C)(C)C)[C@@H](F)c1ccccc1[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H31FO3S/c1-6-9-18(16-22(26)28-24(3,4)5)23(25)20-10-7-8-11-21(20)29(27)19-14-12-17(2)13-15-19/h7-8,10-15,18,23H,6,9,16H2,1-5H3/t18-,23+,29-/m0/s1 |
| InChIKey | DWGLTPOSJNZIEE-AFPDSDBBSA-N |
| XLogP | 6.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |