C31H46O4S2 — CID 135063504
tert-butyl (3R)-3-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]-2-methylundecanoate (PubChem CID 135063504) has the molecular formula C31H46O4S2 and a molecular weight of 546.84 g/mol. Its IUPAC name is tert-butyl (3R)-3-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]-2-methylundecanoate.
| Compound Name | tert-butyl (3R)-3-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]-2-methylundecanoate |
|---|---|
| PubChem CID | 135063504 |
| Molecular Formula | C31H46O4S2 |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | tert-butyl (3R)-3-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]-2-methylundecanoate |
| SMILES | CCCCCCCC[C@H](C(C)C(=O)OC(C)(C)C)C([S@@](=O)c1ccc(C)cc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H46O4S2/c1-8-9-10-11-12-13-14-28(25(4)29(32)35-31(5,6)7)30(36(33)26-19-15-23(2)16-20-26)37(34)27-21-17-24(3)18-22-27/h15-22,25,28,30H,8-14H2,1-7H3/t25?,28-,36+,37+/m1/s1 |
| InChIKey | LFFZRCZDODXVLL-CSYJMRHRSA-N |
| XLogP | 7.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|