C23H26N2O5 — CID 102372500
(5R,9S)-1-benzyl-9-(3,4,5-trimethoxyphenyl)-1,7-diazaspiro[4.4]nonane-2,6-dione (PubChem CID 102372500) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is (5R,9S)-1-benzyl-9-(3,4,5-trimethoxyphenyl)-1,7-diazaspiro[4.4]nonane-2,6-dione.
| Compound Name | (5R,9S)-1-benzyl-9-(3,4,5-trimethoxyphenyl)-1,7-diazaspiro[4.4]nonane-2,6-dione |
|---|---|
| PubChem CID | 102372500 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (5R,9S)-1-benzyl-9-(3,4,5-trimethoxyphenyl)-1,7-diazaspiro[4.4]nonane-2,6-dione |
| SMILES | COc1cc([C@H]2CNC(=O)[C@@]23CCC(=O)N3Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26N2O5/c1-28-18-11-16(12-19(29-2)21(18)30-3)17-13-24-22(27)23(17)10-9-20(26)25(23)14-15-7-5-4-6-8-15/h4-8,11-12,17H,9-10,13-14H2,1-3H3,(H,24,27)/t17-,23-/m1/s1 |
| InChIKey | FTUZZDNHHYOSHW-UZUQRXQVSA-N |
| XLogP | 2.49 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |