C28H42O3 — CID 102373382
(2S,5S)-7,7,7-trideuterio-2-[(1S,2R,5R,7R,10S,11S,14R,15S)-2,15-dimethyl-8-oxo-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-5,6-dimethylheptane-3,4-dione (PubChem CID 102373382) has the molecular formula C28H42O3 and a molecular weight of 429.66 g/mol. Its IUPAC name is (2S,5S)-7,7,7-trideuterio-2-[(1S,2R,5R,7R,10S,11S,14R,15S)-2,15-dimethyl-8-oxo-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-5,6-dimethylheptane-3,4-dione.
| Compound Name | (2S,5S)-7,7,7-trideuterio-2-[(1S,2R,5R,7R,10S,11S,14R,15S)-2,15-dimethyl-8-oxo-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-5,6-dimethylheptane-3,4-dione |
|---|---|
| PubChem CID | 102373382 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.33 |
| IUPAC Name | (2S,5S)-7,7,7-trideuterio-2-[(1S,2R,5R,7R,10S,11S,14R,15S)-2,15-dimethyl-8-oxo-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-5,6-dimethylheptane-3,4-dione |
| SMILES | [2H]C([2H])([2H])C(C)[C@H](C)C(=O)C(=O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(=O)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H42O3/c1-15(2)16(3)24(30)25(31)17(4)20-7-8-21-19-13-23(29)28-14-18(28)9-12-27(28,6)22(19)10-11-26(20,21)5/h15-22H,7-14H2,1-6H3/t16-,17-,18+,19-,20+,21-,22-,26+,27+,28-/m0/s1/i1D3/t15?,16-,17-,18+,19-,20+,21-,22-,26+,27+,28- |
| InChIKey | VATZEBRCLPAPEC-DGMAJZNKSA-N |
| XLogP | 5.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|