C23H34O3 — CID 14053285
methyl (2S)-2-[(1S,2R,5R,7R,10S,11S,14R,15S)-2,15-dimethyl-8-oxo-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]propanoate (PubChem CID 14053285) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is methyl (2S)-2-[(1S,2R,5R,7R,10S,11S,14R,15S)-2,15-dimethyl-8-oxo-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]propanoate.
| Compound Name | methyl (2S)-2-[(1S,2R,5R,7R,10S,11S,14R,15S)-2,15-dimethyl-8-oxo-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]propanoate |
|---|---|
| PubChem CID | 14053285 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | methyl (2S)-2-[(1S,2R,5R,7R,10S,11S,14R,15S)-2,15-dimethyl-8-oxo-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(=O)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H34O3/c1-13(20(25)26-4)16-5-6-17-15-11-19(24)23-12-14(23)7-10-22(23,3)18(15)8-9-21(16,17)2/h13-18H,5-12H2,1-4H3/t13-,14+,15-,16+,17-,18-,21+,22+,23-/m0/s1 |
| InChIKey | JGWROPWUWAOWER-OTUSMCIRSA-N |
| XLogP | 4.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |