C14H16ClFN2O3S2 — CID 10237339
3-chloro-N-[5-[2-(2-fluoroethoxy)ethyl]-1,3-thiazol-2-yl]-2-methylbenzenesulfonamide (PubChem CID 10237339) has the molecular formula C14H16ClFN2O3S2 and a molecular weight of 378.88 g/mol. Its IUPAC name is 3-chloro-N-[5-[2-(2-fluoroethoxy)ethyl]-1,3-thiazol-2-yl]-2-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[5-[2-(2-fluoroethoxy)ethyl]-1,3-thiazol-2-yl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10237339 |
| Molecular Formula | C14H16ClFN2O3S2 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 3-chloro-N-[5-[2-(2-fluoroethoxy)ethyl]-1,3-thiazol-2-yl]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1ncc(CCOCCF)s1 |
| InChI | InChI=1S/C14H16ClFN2O3S2/c1-10-12(15)3-2-4-13(10)23(19,20)18-14-17-9-11(22-14)5-7-21-8-6-16/h2-4,9H,5-8H2,1H3,(H,17,18) |
| InChIKey | YYFQVOXGGMZYGW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|