C21H21NOS — CID 102375157
N-butyl-2,4-diphenylthiophene-3-carboxamide (PubChem CID 102375157) has the molecular formula C21H21NOS and a molecular weight of 335.47 g/mol. Its IUPAC name is N-butyl-2,4-diphenylthiophene-3-carboxamide.
| Compound Name | N-butyl-2,4-diphenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 102375157 |
| Molecular Formula | C21H21NOS |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-butyl-2,4-diphenylthiophene-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(-c2ccccc2)csc1-c1ccccc1 |
| InChI | InChI=1S/C21H21NOS/c1-2-3-14-22-21(23)19-18(16-10-6-4-7-11-16)15-24-20(19)17-12-8-5-9-13-17/h4-13,15H,2-3,14H2,1H3,(H,22,23) |
| InChIKey | VVIWWKPWZODFQG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|