C14H20Br2S2 — CID 102375335
1,5-dibromo-2,4-bis(butylsulfanyl)benzene (PubChem CID 102375335) has the molecular formula C14H20Br2S2 and a molecular weight of 412.26 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis(butylsulfanyl)benzene.
| Compound Name | 1,5-dibromo-2,4-bis(butylsulfanyl)benzene |
|---|---|
| PubChem CID | 102375335 |
| Molecular Formula | C14H20Br2S2 |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 409.94 |
| IUPAC Name | 1,5-dibromo-2,4-bis(butylsulfanyl)benzene |
| SMILES | CCCCSc1cc(SCCCC)c(Br)cc1Br |
| InChI | InChI=1S/C14H20Br2S2/c1-3-5-7-17-13-10-14(18-8-6-4-2)12(16)9-11(13)15/h9-10H,3-8H2,1-2H3 |
| InChIKey | UQTVUPQHFSHIGQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|