C25H35NO4Si — CID 102375366
tert-butyl (2S)-3-phenyl-2-[(2-phenyl-2-trimethylsilylethoxy)carbonylamino]propanoate (PubChem CID 102375366) has the molecular formula C25H35NO4Si and a molecular weight of 441.64 g/mol. Its IUPAC name is tert-butyl (2S)-3-phenyl-2-[(2-phenyl-2-trimethylsilylethoxy)carbonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-phenyl-2-[(2-phenyl-2-trimethylsilylethoxy)carbonylamino]propanoate |
|---|---|
| PubChem CID | 102375366 |
| Molecular Formula | C25H35NO4Si |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | tert-butyl (2S)-3-phenyl-2-[(2-phenyl-2-trimethylsilylethoxy)carbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)NC(=O)OCC(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C25H35NO4Si/c1-25(2,3)30-23(27)21(17-19-13-9-7-10-14-19)26-24(28)29-18-22(31(4,5)6)20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3,(H,26,28)/t21-,22?/m0/s1 |
| InChIKey | WMMRQNZMJWXCDH-HMTLIYDFSA-N |
| XLogP | 5.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|