C32H48O10Ti2 — CID 102375541
9,10-dioxoanthracene-1,8-diolate;hexakis(propan-2-olate);bis(titanium(4+)) (PubChem CID 102375541) has the molecular formula C32H48O10Ti2 and a molecular weight of 688.46 g/mol. Its IUPAC name is 9,10-dioxoanthracene-1,8-diolate;hexakis(propan-2-olate);bis(titanium(4+)).
| Compound Name | 9,10-dioxoanthracene-1,8-diolate;hexakis(propan-2-olate);bis(titanium(4+)) |
|---|---|
| PubChem CID | 102375541 |
| Molecular Formula | C32H48O10Ti2 |
| Molecular Weight | 688.46 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | 9,10-dioxoanthracene-1,8-diolate;hexakis(propan-2-olate);bis(titanium(4+)) |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-].O=C1c2cccc([O-])c2C(=O)c2c([O-])cccc21.[Ti+4].[Ti+4] |
| InChI | InChI=1S/C14H8O4.6C3H7O.2Ti/c15-9-5-1-3-7-11(9)14(18)12-8(13(7)17)4-2-6-10(12)16;6*1-3(2)4;;/h1-6,15-16H;6*3H,1-2H3;;/q;6*-1;2*+4/p-2 |
| InChIKey | PDINXZSVIPQMFD-UHFFFAOYSA-L |
| XLogP | -0.87 |
| TPSA | 218.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.46 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|