C30H30N2O5 — CID 102377317
1-O'-benzyl 9-O-methyl (2R,3S,6R,7S,8S)-1-ethenyl-7-(hydroxymethyl)spiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,4'-quinoline]-1',9-dicarboxylate (PubChem CID 102377317) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 1-O'-benzyl 9-O-methyl (2R,3S,6R,7S,8S)-1-ethenyl-7-(hydroxymethyl)spiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,4'-quinoline]-1',9-dicarboxylate.
| Compound Name | 1-O'-benzyl 9-O-methyl (2R,3S,6R,7S,8S)-1-ethenyl-7-(hydroxymethyl)spiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,4'-quinoline]-1',9-dicarboxylate |
|---|---|
| PubChem CID | 102377317 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 1-O'-benzyl 9-O-methyl (2R,3S,6R,7S,8S)-1-ethenyl-7-(hydroxymethyl)spiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,4'-quinoline]-1',9-dicarboxylate |
| SMILES | C=CC12CN(C(=O)OC)[C@@H]3[C@@H](CO)[C@H]1C=C[C@]1(C=CN(C(=O)OCc4ccccc4)c4ccccc41)[C@@H]32 |
| InChI | InChI=1S/C30H30N2O5/c1-3-29-19-32(27(34)36-2)25-21(17-33)22(29)13-14-30(26(25)29)15-16-31(24-12-8-7-11-23(24)30)28(35)37-18-20-9-5-4-6-10-20/h3-16,21-22,25-26,33H,1,17-19H2,2H3/t21-,22+,25+,26-,29?,30+/m0/s1 |
| InChIKey | PMYNNQGAJOKTJY-GZRUXTJASA-N |
| XLogP | 4.64 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|