C23H25BrN2O5 — CID 10939888
methyl (1R,2S,3R,6S,7R,8S)-7-bromo-1-ethenyl-4-methoxy-1'-(methoxymethyl)-2'-oxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-9-carboxylate (PubChem CID 10939888) has the molecular formula C23H25BrN2O5 and a molecular weight of 489.37 g/mol. Its IUPAC name is methyl (1R,2S,3R,6S,7R,8S)-7-bromo-1-ethenyl-4-methoxy-1'-(methoxymethyl)-2'-oxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-9-carboxylate.
| Compound Name | methyl (1R,2S,3R,6S,7R,8S)-7-bromo-1-ethenyl-4-methoxy-1'-(methoxymethyl)-2'-oxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-9-carboxylate |
|---|---|
| PubChem CID | 10939888 |
| Molecular Formula | C23H25BrN2O5 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | methyl (1R,2S,3R,6S,7R,8S)-7-bromo-1-ethenyl-4-methoxy-1'-(methoxymethyl)-2'-oxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-9-carboxylate |
| SMILES | C=C[C@]12CN(C(=O)OC)[C@@H]3[C@H](Br)[C@H]1C=C(OC)[C@@]1(C(=O)N(COC)c4ccccc41)[C@@H]32 |
| InChI | InChI=1S/C23H25BrN2O5/c1-5-22-11-25(21(28)31-4)18-17(24)14(22)10-16(30-3)23(19(18)22)13-8-6-7-9-15(13)26(12-29-2)20(23)27/h5-10,14,17-19H,1,11-12H2,2-4H3/t14-,17-,18-,19+,22+,23-/m1/s1 |
| InChIKey | JMMLPWOCJDIEAM-OPQZPQMISA-N |
| XLogP | 3.05 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|