C22H24N2O4 — CID 11731674
(1R,2S,6R,7S,8S)-1-ethenyl-7-(hydroxymethyl)-1'-(methoxymethyl)-9-methylspiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-2',10-dione (PubChem CID 11731674) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (1R,2S,6R,7S,8S)-1-ethenyl-7-(hydroxymethyl)-1'-(methoxymethyl)-9-methylspiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-2',10-dione.
| Compound Name | (1R,2S,6R,7S,8S)-1-ethenyl-7-(hydroxymethyl)-1'-(methoxymethyl)-9-methylspiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-2',10-dione |
|---|---|
| PubChem CID | 11731674 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (1R,2S,6R,7S,8S)-1-ethenyl-7-(hydroxymethyl)-1'-(methoxymethyl)-9-methylspiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-2',10-dione |
| SMILES | C=C[C@@]12C(=O)N(C)[C@@H]3[C@@H](CO)[C@H]1C=CC1(C(=O)N(COC)c4ccccc41)[C@@H]32 |
| InChI | InChI=1S/C22H24N2O4/c1-4-21-14-9-10-22(18(21)17(13(14)11-25)23(2)19(21)26)15-7-5-6-8-16(15)24(12-28-3)20(22)27/h4-10,13-14,17-18,25H,1,11-12H2,2-3H3/t13-,14+,17+,18-,21+,22?/m0/s1 |
| InChIKey | RKOZZCCNPWNWBI-KIIAVHFBSA-N |
| XLogP | 1.31 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|