C26H34N2O4Si — CID 10939575
(1R,2S,5S,6S,7S,8R,11S)-2-ethenyl-4-methyl-1'-(2-trimethylsilylethoxymethyl)spiro[9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-7,3'-indole]-2',3-dione (PubChem CID 10939575) has the molecular formula C26H34N2O4Si and a molecular weight of 466.65 g/mol. Its IUPAC name is (1R,2S,5S,6S,7S,8R,11S)-2-ethenyl-4-methyl-1'-(2-trimethylsilylethoxymethyl)spiro[9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-7,3'-indole]-2',3-dione.
| Compound Name | (1R,2S,5S,6S,7S,8R,11S)-2-ethenyl-4-methyl-1'-(2-trimethylsilylethoxymethyl)spiro[9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-7,3'-indole]-2',3-dione |
|---|---|
| PubChem CID | 10939575 |
| Molecular Formula | C26H34N2O4Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | (1R,2S,5S,6S,7S,8R,11S)-2-ethenyl-4-methyl-1'-(2-trimethylsilylethoxymethyl)spiro[9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-7,3'-indole]-2',3-dione |
| SMILES | C=C[C@]12C(=O)N(C)[C@@H]3[C@H]4CO[C@H](C[C@H]41)[C@]1(C(=O)N(COCC[Si](C)(C)C)c4ccccc41)[C@@H]32 |
| InChI | InChI=1S/C26H34N2O4Si/c1-6-25-18-13-20-26(22(25)21(16(18)14-32-20)27(2)23(25)29)17-9-7-8-10-19(17)28(24(26)30)15-31-11-12-33(3,4)5/h6-10,16,18,20-22H,1,11-15H2,2-5H3/t16-,18+,20+,21+,22-,25-,26-/m0/s1 |
| InChIKey | XMZAJHWOKMKLCZ-JSFFYKACSA-N |
| XLogP | 3.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|