C21H26N2O4 — CID 162934268
(1S,2R,5S,6R,7R,8S,11R)-2-[(1R)-1-hydroxyethyl]-1'-methoxy-4-methylspiro[9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-7,3'-indole]-2'-one (PubChem CID 162934268) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R,8S,11R)-2-[(1R)-1-hydroxyethyl]-1'-methoxy-4-methylspiro[9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-7,3'-indole]-2'-one.
| Compound Name | (1S,2R,5S,6R,7R,8S,11R)-2-[(1R)-1-hydroxyethyl]-1'-methoxy-4-methylspiro[9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 162934268 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1S,2R,5S,6R,7R,8S,11R)-2-[(1R)-1-hydroxyethyl]-1'-methoxy-4-methylspiro[9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-7,3'-indole]-2'-one |
| SMILES | CON1C(=O)[C@]2(c3ccccc31)[C@@H]1C[C@H]3[C@@H](CO1)[C@@H]1[C@@H]2[C@@]3([C@@H](C)O)CN1C |
| InChI | InChI=1S/C21H26N2O4/c1-11(24)20-10-22(2)17-12-9-27-16(8-14(12)20)21(18(17)20)13-6-4-5-7-15(13)23(26-3)19(21)25/h4-7,11-12,14,16-18,24H,8-10H2,1-3H3/t11-,12-,14+,16+,17-,18-,20-,21-/m1/s1 |
| InChIKey | HNTFOMODUWFBCP-RLUWQFLFSA-N |
| XLogP | 1.18 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |