C29H28N2O5 — CID 11202543
[(1S,2S,3S,6R,7S,8S)-1-ethenyl-1'-(methoxymethyl)-9-methyl-2',10-dioxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-7-yl]methyl benzoate (PubChem CID 11202543) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is [(1S,2S,3S,6R,7S,8S)-1-ethenyl-1'-(methoxymethyl)-9-methyl-2',10-dioxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-7-yl]methyl benzoate.
| Compound Name | [(1S,2S,3S,6R,7S,8S)-1-ethenyl-1'-(methoxymethyl)-9-methyl-2',10-dioxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-7-yl]methyl benzoate |
|---|---|
| PubChem CID | 11202543 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [(1S,2S,3S,6R,7S,8S)-1-ethenyl-1'-(methoxymethyl)-9-methyl-2',10-dioxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-7-yl]methyl benzoate |
| SMILES | C=C[C@]12C(=O)N(C)[C@@H]3[C@@H](COC(=O)c4ccccc4)[C@H]1C=C[C@]1(C(=O)N(COC)c4ccccc41)[C@@H]32 |
| InChI | InChI=1S/C29H28N2O5/c1-4-28-20-14-15-29(21-12-8-9-13-22(21)31(17-35-3)27(29)34)24(28)23(30(2)26(28)33)19(20)16-36-25(32)18-10-6-5-7-11-18/h4-15,19-20,23-24H,1,16-17H2,2-3H3/t19-,20+,23+,24-,28-,29+/m0/s1 |
| InChIKey | COANOUUOXSNXFO-QPXOTDQZSA-N |
| XLogP | 3.18 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|