C24H26N2O4 — CID 102206063
[3-(cyclohexylcarbamoyl)-1-ethyl-2-oxoindol-3-yl] benzoate (PubChem CID 102206063) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is [3-(cyclohexylcarbamoyl)-1-ethyl-2-oxoindol-3-yl] benzoate.
| Compound Name | [3-(cyclohexylcarbamoyl)-1-ethyl-2-oxoindol-3-yl] benzoate |
|---|---|
| PubChem CID | 102206063 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [3-(cyclohexylcarbamoyl)-1-ethyl-2-oxoindol-3-yl] benzoate |
| SMILES | CCN1C(=O)C(OC(=O)c2ccccc2)(C(=O)NC2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C24H26N2O4/c1-2-26-20-16-10-9-15-19(20)24(23(26)29,22(28)25-18-13-7-4-8-14-18)30-21(27)17-11-5-3-6-12-17/h3,5-6,9-12,15-16,18H,2,4,7-8,13-14H2,1H3,(H,25,28) |
| InChIKey | POBYVDWFSCSREM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|