C17H21N3O3 — CID 41024763
N-cyclopentyl-N'-[(3R)-1-ethyl-2-oxo-3H-indol-3-yl]oxamide (PubChem CID 41024763) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-cyclopentyl-N'-[(3R)-1-ethyl-2-oxo-3H-indol-3-yl]oxamide.
| Compound Name | N-cyclopentyl-N'-[(3R)-1-ethyl-2-oxo-3H-indol-3-yl]oxamide |
|---|---|
| PubChem CID | 41024763 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-cyclopentyl-N'-[(3R)-1-ethyl-2-oxo-3H-indol-3-yl]oxamide |
| SMILES | CCN1C(=O)[C@H](NC(=O)C(=O)NC2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C17H21N3O3/c1-2-20-13-10-6-5-9-12(13)14(17(20)23)19-16(22)15(21)18-11-7-3-4-8-11/h5-6,9-11,14H,2-4,7-8H2,1H3,(H,18,21)(H,19,22)/t14-/m1/s1 |
| InChIKey | UVZNDFYUBXLDHA-CQSZACIVSA-N |
| XLogP | 1.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|