C21H31N3O4 — CID 22013048
1-cyclohexyl-3-[1-(2,2-diethoxyethyl)-2-oxo-3H-indol-3-yl]urea (PubChem CID 22013048) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(2,2-diethoxyethyl)-2-oxo-3H-indol-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-(2,2-diethoxyethyl)-2-oxo-3H-indol-3-yl]urea |
|---|---|
| PubChem CID | 22013048 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 1-cyclohexyl-3-[1-(2,2-diethoxyethyl)-2-oxo-3H-indol-3-yl]urea |
| SMILES | CCOC(CN1C(=O)C(NC(=O)NC2CCCCC2)c2ccccc21)OCC |
| InChI | InChI=1S/C21H31N3O4/c1-3-27-18(28-4-2)14-24-17-13-9-8-12-16(17)19(20(24)25)23-21(26)22-15-10-6-5-7-11-15/h8-9,12-13,15,18-19H,3-7,10-11,14H2,1-2H3,(H2,22,23,26) |
| InChIKey | WEXVHHGVMCRYKJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|