C21H24ClN3O4 — CID 22012987
1-(4-chlorophenyl)-3-[1-(2,2-diethoxyethyl)-2-oxo-3H-indol-3-yl]urea (PubChem CID 22012987) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[1-(2,2-diethoxyethyl)-2-oxo-3H-indol-3-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[1-(2,2-diethoxyethyl)-2-oxo-3H-indol-3-yl]urea |
|---|---|
| PubChem CID | 22012987 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[1-(2,2-diethoxyethyl)-2-oxo-3H-indol-3-yl]urea |
| SMILES | CCOC(CN1C(=O)C(NC(=O)Nc2ccc(Cl)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C21H24ClN3O4/c1-3-28-18(29-4-2)13-25-17-8-6-5-7-16(17)19(20(25)26)24-21(27)23-15-11-9-14(22)10-12-15/h5-12,18-19H,3-4,13H2,1-2H3,(H2,23,24,27) |
| InChIKey | DDMKAFUJMLMDMW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|