C22H32N2O2 — CID 162804419
2-[(3S,4S)-1-benzoyl-3-ethylpiperidin-4-yl]-N-cyclohexylacetamide (PubChem CID 162804419) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-[(3S,4S)-1-benzoyl-3-ethylpiperidin-4-yl]-N-cyclohexylacetamide.
| Compound Name | 2-[(3S,4S)-1-benzoyl-3-ethylpiperidin-4-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 162804419 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 2-[(3S,4S)-1-benzoyl-3-ethylpiperidin-4-yl]-N-cyclohexylacetamide |
| SMILES | CC[C@@H]1CN(C(=O)c2ccccc2)CC[C@H]1CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H32N2O2/c1-2-17-16-24(22(26)18-9-5-3-6-10-18)14-13-19(17)15-21(25)23-20-11-7-4-8-12-20/h3,5-6,9-10,17,19-20H,2,4,7-8,11-16H2,1H3,(H,23,25)/t17-,19+/m1/s1 |
| InChIKey | TYDVSRURAZWLCY-MJGOQNOKSA-N |
| XLogP | 4.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |