C25H32N2O4 — CID 73147830
2-(1-benzoyl-3-ethylpiperidin-4-yl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide (PubChem CID 73147830) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-(1-benzoyl-3-ethylpiperidin-4-yl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(1-benzoyl-3-ethylpiperidin-4-yl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 73147830 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 2-(1-benzoyl-3-ethylpiperidin-4-yl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
| SMILES | CCC1CN(C(=O)c2ccccc2)CCC1CC(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H32N2O4/c1-4-19-17-27(25(29)20-8-6-5-7-9-20)13-12-21(19)15-24(28)26-16-18-10-11-22(30-2)23(14-18)31-3/h5-11,14,19,21H,4,12-13,15-17H2,1-3H3,(H,26,28) |
| InChIKey | GWQMGVJSWBAJSF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |