C21H26N2O2S — CID 163162329
2-[(3S,4S)-1-benzoyl-3-ethylpiperidin-4-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 163162329) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 2-[(3S,4S)-1-benzoyl-3-ethylpiperidin-4-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(3S,4S)-1-benzoyl-3-ethylpiperidin-4-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 163162329 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[(3S,4S)-1-benzoyl-3-ethylpiperidin-4-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC[C@@H]1CN(C(=O)c2ccccc2)CC[C@H]1CC(=O)NCc1cccs1 |
| InChI | InChI=1S/C21H26N2O2S/c1-2-16-15-23(21(25)17-7-4-3-5-8-17)11-10-18(16)13-20(24)22-14-19-9-6-12-26-19/h3-9,12,16,18H,2,10-11,13-15H2,1H3,(H,22,24)/t16-,18+/m1/s1 |
| InChIKey | RKQHVQBDFKHXPM-AEFFLSMTSA-N |
| XLogP | 3.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |