C30H29N3O4 — CID 11248959
[(1S,2S,3S,6R,7S,8S,10R)-10-cyano-1-ethenyl-1'-(methoxymethyl)-9-methyl-2'-oxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-7-yl]methyl benzoate (PubChem CID 11248959) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is [(1S,2S,3S,6R,7S,8S,10R)-10-cyano-1-ethenyl-1'-(methoxymethyl)-9-methyl-2'-oxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-7-yl]methyl benzoate.
| Compound Name | [(1S,2S,3S,6R,7S,8S,10R)-10-cyano-1-ethenyl-1'-(methoxymethyl)-9-methyl-2'-oxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-7-yl]methyl benzoate |
|---|---|
| PubChem CID | 11248959 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | [(1S,2S,3S,6R,7S,8S,10R)-10-cyano-1-ethenyl-1'-(methoxymethyl)-9-methyl-2'-oxospiro[9-azatricyclo[4.4.0.02,8]dec-4-ene-3,3'-indole]-7-yl]methyl benzoate |
| SMILES | C=C[C@]12[C@@H]3C=C[C@]4(C(=O)N(COC)c5ccccc54)[C@H]1[C@@H]([C@H]3COC(=O)c1ccccc1)N(C)[C@H]2C#N |
| InChI | InChI=1S/C30H29N3O4/c1-4-29-21-14-15-30(22-12-8-9-13-23(22)33(18-36-3)28(30)35)26(29)25(32(2)24(29)16-31)20(21)17-37-27(34)19-10-6-5-7-11-19/h4-15,20-21,24-26H,1,17-18H2,2-3H3/t20-,21+,24-,25+,26-,29+,30+/m0/s1 |
| InChIKey | ITIVCZPHWKRULO-VGSJMRRBSA-N |
| XLogP | 3.54 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|