C23H17N3O3 — CID 102103355
(2R,5E)-5-benzylidene-1'-(methoxymethyl)-2',4-dioxospiro[cyclopentane-2,3'-indole]-1,1-dicarbonitrile (PubChem CID 102103355) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is (2R,5E)-5-benzylidene-1'-(methoxymethyl)-2',4-dioxospiro[cyclopentane-2,3'-indole]-1,1-dicarbonitrile.
| Compound Name | (2R,5E)-5-benzylidene-1'-(methoxymethyl)-2',4-dioxospiro[cyclopentane-2,3'-indole]-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 102103355 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (2R,5E)-5-benzylidene-1'-(methoxymethyl)-2',4-dioxospiro[cyclopentane-2,3'-indole]-1,1-dicarbonitrile |
| SMILES | COCN1C(=O)[C@]2(CC(=O)/C(=C/c3ccccc3)C2(C#N)C#N)c2ccccc21 |
| InChI | InChI=1S/C23H17N3O3/c1-29-15-26-19-10-6-5-9-17(19)23(21(26)28)12-20(27)18(22(23,13-24)14-25)11-16-7-3-2-4-8-16/h2-11H,12,15H2,1H3/b18-11-/t23-/m0/s1 |
| InChIKey | AXNXFNCMPQYDQV-RXATWSHQSA-N |
| XLogP | 2.96 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|