C23H18F2O6S — CID 102378972
3-[3,5-bis(4-fluorobenzoyl)phenoxy]propane-1-sulfonic acid (PubChem CID 102378972) has the molecular formula C23H18F2O6S and a molecular weight of 460.45 g/mol. Its IUPAC name is 3-[3,5-bis(4-fluorobenzoyl)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[3,5-bis(4-fluorobenzoyl)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 102378972 |
| Molecular Formula | C23H18F2O6S |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 3-[3,5-bis(4-fluorobenzoyl)phenoxy]propane-1-sulfonic acid |
| SMILES | O=C(c1ccc(F)cc1)c1cc(OCCCS(=O)(=O)O)cc(C(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H18F2O6S/c24-19-6-2-15(3-7-19)22(26)17-12-18(23(27)16-4-8-20(25)9-5-16)14-21(13-17)31-10-1-11-32(28,29)30/h2-9,12-14H,1,10-11H2,(H,28,29,30) |
| InChIKey | KFPKWRWTKPGLNY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|