C30H39NO3S — CID 102379671
[(3S,3'R,5S,8R,9S,10S,13S,14S,17S)-3'-(1,3-benzothiazol-2-yl)-3',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] acetate (PubChem CID 102379671) has the molecular formula C30H39NO3S and a molecular weight of 493.71 g/mol. Its IUPAC name is [(3S,3'R,5S,8R,9S,10S,13S,14S,17S)-3'-(1,3-benzothiazol-2-yl)-3',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] acetate.
| Compound Name | [(3S,3'R,5S,8R,9S,10S,13S,14S,17S)-3'-(1,3-benzothiazol-2-yl)-3',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] acetate |
|---|---|
| PubChem CID | 102379671 |
| Molecular Formula | C30H39NO3S |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | [(3S,3'R,5S,8R,9S,10S,13S,14S,17S)-3'-(1,3-benzothiazol-2-yl)-3',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CC[C@]23O[C@@]3(C)c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C30H39NO3S/c1-18(32)33-20-11-14-27(2)19(17-20)9-10-21-22(27)12-15-28(3)23(21)13-16-30(28)29(4,34-30)26-31-24-7-5-6-8-25(24)35-26/h5-8,19-23H,9-17H2,1-4H3/t19-,20-,21+,22-,23-,27-,28-,29-,30-/m0/s1 |
| InChIKey | GGROSMXHPCWMLY-PRYMTPOTSA-N |
| XLogP | 7.25 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|