C27H37NO3 — CID 102379673
[(3R,3'R,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3'-pyridin-2-ylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] acetate (PubChem CID 102379673) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is [(3R,3'R,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3'-pyridin-2-ylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] acetate.
| Compound Name | [(3R,3'R,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3'-pyridin-2-ylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] acetate |
|---|---|
| PubChem CID | 102379673 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | [(3R,3'R,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3'-pyridin-2-ylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-oxirane]-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CC[C@]23O[C@@H]3c2ccccn2)C1 |
| InChI | InChI=1S/C27H37NO3/c1-17(29)30-19-9-12-25(2)18(16-19)7-8-20-21(25)10-13-26(3)22(20)11-14-27(26)24(31-27)23-6-4-5-15-28-23/h4-6,15,18-22,24H,7-14,16H2,1-3H3/t18-,19+,20+,21-,22-,24+,25-,26-,27+/m0/s1 |
| InChIKey | WHSMEXDWHPDXQV-QRLKCPOJSA-N |
| XLogP | 5.87 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|