C26H26N2O — CID 102380253
2-[(2S,3S)-3-deuterio-1-tritylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 102380253) has the molecular formula C26H26N2O and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-[(2S,3S)-3-deuterio-1-tritylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2S,3S)-3-deuterio-1-tritylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 102380253 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-[(2S,3S)-3-deuterio-1-tritylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | [2H][C@H]1[C@@H](C2=NC(C)(C)CO2)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O/c1-25(2)19-29-24(27-25)23-18-28(23)26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,23H,18-19H2,1-2H3/t23-,28?/m0/s1/i18D/t18-,23-,28? |
| InChIKey | ZCPPIWUINWGAKX-HTATYHQASA-N |
| XLogP | 4.87 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|