C12H14N2O — CID 91616257
2-(1-benzylaziridin-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 91616257) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(1-benzylaziridin-2-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(1-benzylaziridin-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 91616257 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-(1-benzylaziridin-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(CN2CC2C2=NCCO2)cc1 |
| InChI | InChI=1S/C12H14N2O/c1-2-4-10(5-3-1)8-14-9-11(14)12-13-6-7-15-12/h1-5,11H,6-9H2 |
| InChIKey | VWMNLULXQAFHRX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|