C13H18O5 — CID 102381405
diethyl (3aS,6R,6aR)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-4,6-dicarboxylate (PubChem CID 102381405) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is diethyl (3aS,6R,6aR)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-4,6-dicarboxylate.
| Compound Name | diethyl (3aS,6R,6aR)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-4,6-dicarboxylate |
|---|---|
| PubChem CID | 102381405 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | diethyl (3aS,6R,6aR)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-4,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](C(=O)OCC)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C13H18O5/c1-3-17-12(14)8-5-9(13(15)18-4-2)11-7-16-6-10(8)11/h5,8,10-11H,3-4,6-7H2,1-2H3/t8-,10+,11-/m1/s1 |
| InChIKey | ZNFQJZAAZRMVMP-DVVUODLYSA-N |
| XLogP | 0.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |