C14H20O6 — CID 10334056
triethyl (1R,2R)-cyclopent-3-ene-1,2,3-tricarboxylate (PubChem CID 10334056) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is triethyl (1R,2R)-cyclopent-3-ene-1,2,3-tricarboxylate.
| Compound Name | triethyl (1R,2R)-cyclopent-3-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 10334056 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | triethyl (1R,2R)-cyclopent-3-ene-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C1=CC[C@@H](C(=O)OCC)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C14H20O6/c1-4-18-12(15)9-7-8-10(13(16)19-5-2)11(9)14(17)20-6-3/h7,10-11H,4-6,8H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | SVKZQDFJAKNWHJ-MNOVXSKESA-N |
| XLogP | 1.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|