C23H32N2O4 — CID 102381818
ethyl 4-[benzyl(2-methoxycarbonylprop-2-enyl)amino]-4-prop-2-enylpiperidine-1-carboxylate (PubChem CID 102381818) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethyl 4-[benzyl(2-methoxycarbonylprop-2-enyl)amino]-4-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | ethyl 4-[benzyl(2-methoxycarbonylprop-2-enyl)amino]-4-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 102381818 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | ethyl 4-[benzyl(2-methoxycarbonylprop-2-enyl)amino]-4-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CCC1(N(CC(=C)C(=O)OC)Cc2ccccc2)CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C23H32N2O4/c1-5-12-23(13-15-24(16-14-23)22(27)29-6-2)25(17-19(3)21(26)28-4)18-20-10-8-7-9-11-20/h5,7-11H,1,3,6,12-18H2,2,4H3 |
| InChIKey | PSKCJPNVOOIDEB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|