C22H26O10 — CID 102382137
[(2R,3S,6S)-3-acetyloxy-6-[2-[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 102382137) has the molecular formula C22H26O10 and a molecular weight of 450.44 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[2-[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[2-[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102382137 |
| Molecular Formula | C22H26O10 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[2-[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#C[C@@H]2C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H26O10/c1-13(23)27-11-21-19(29-15(3)25)9-7-17(31-21)5-6-18-8-10-20(30-16(4)26)22(32-18)12-28-14(2)24/h7-10,17-22H,11-12H2,1-4H3/t17-,18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | FLTSGHLJCISSBH-KQFPAPQFSA-N |
| XLogP | 0.63 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|