C38H46N2+2 — CID 102382278
trimethyl-[[3-[2-[4-[2-(4-oct-1-ynylphenyl)ethynyl]phenyl]ethynyl]-5-[(trimethylazaniumyl)methyl]phenyl]methyl]azanium (PubChem CID 102382278) has the molecular formula C38H46N2+2 and a molecular weight of 530.80 g/mol. Its IUPAC name is trimethyl-[[3-[2-[4-[2-(4-oct-1-ynylphenyl)ethynyl]phenyl]ethynyl]-5-[(trimethylazaniumyl)methyl]phenyl]methyl]azanium.
| Compound Name | trimethyl-[[3-[2-[4-[2-(4-oct-1-ynylphenyl)ethynyl]phenyl]ethynyl]-5-[(trimethylazaniumyl)methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 102382278 |
| Molecular Formula | C38H46N2+2 |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.37 |
| IUPAC Name | trimethyl-[[3-[2-[4-[2-(4-oct-1-ynylphenyl)ethynyl]phenyl]ethynyl]-5-[(trimethylazaniumyl)methyl]phenyl]methyl]azanium |
| SMILES | CCCCCCC#Cc1ccc(C#Cc2ccc(C#Cc3cc(C[N+](C)(C)C)cc(C[N+](C)(C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C38H46N2/c1-8-9-10-11-12-13-14-32-15-17-33(18-16-32)19-20-34-21-23-35(24-22-34)25-26-36-27-37(30-39(2,3)4)29-38(28-36)31-40(5,6)7/h15-18,21-24,27-29H,8-12,30-31H2,1-7H3/q+2 |
| InChIKey | MNLLRMWLNDMMKL-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|