C32H29F3N2O4 — CID 1023824
(4R,7R)-4-(2,3-dimethoxyphenyl)-2-methyl-5-oxo-7-phenyl-N-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 1023824) has the molecular formula C32H29F3N2O4 and a molecular weight of 562.59 g/mol. Its IUPAC name is (4R,7R)-4-(2,3-dimethoxyphenyl)-2-methyl-5-oxo-7-phenyl-N-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4R,7R)-4-(2,3-dimethoxyphenyl)-2-methyl-5-oxo-7-phenyl-N-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 1023824 |
| Molecular Formula | C32H29F3N2O4 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (4R,7R)-4-(2,3-dimethoxyphenyl)-2-methyl-5-oxo-7-phenyl-N-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | COc1cccc([C@H]2C(C(=O)Nc3ccccc3C(F)(F)F)=C(C)NC3=C2C(=O)C[C@H](c2ccccc2)C3)c1OC |
| InChI | InChI=1S/C32H29F3N2O4/c1-18-27(31(39)37-23-14-8-7-13-22(23)32(33,34)35)28(21-12-9-15-26(40-2)30(21)41-3)29-24(36-18)16-20(17-25(29)38)19-10-5-4-6-11-19/h4-15,20,28,36H,16-17H2,1-3H3,(H,37,39)/t20-,28+/m1/s1 |
| InChIKey | GMRRHMKRKFFTPD-NGOKVRLYSA-N |
| XLogP | 6.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |