C32H31FN2O4 — CID 28925188
(4R,7S)-7-(3,4-dimethoxyphenyl)-4-(2-fluorophenyl)-2-methyl-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 28925188) has the molecular formula C32H31FN2O4 and a molecular weight of 526.61 g/mol. Its IUPAC name is (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(2-fluorophenyl)-2-methyl-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(2-fluorophenyl)-2-methyl-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 28925188 |
| Molecular Formula | C32H31FN2O4 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(2-fluorophenyl)-2-methyl-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)Nc2ccccc2C)[C@@H]3c2ccccc2F)cc1OC |
| InChI | InChI=1S/C32H31FN2O4/c1-18-9-5-8-12-24(18)35-32(37)29-19(2)34-25-15-21(20-13-14-27(38-3)28(17-20)39-4)16-26(36)31(25)30(29)22-10-6-7-11-23(22)33/h5-14,17,21,30,34H,15-16H2,1-4H3,(H,35,37)/t21-,30-/m0/s1 |
| InChIKey | FAKOAUJQYDRUKZ-JRPXNJEYSA-N |
| XLogP | 6.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |