C31H32N2O4S — CID 28925181
(4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-N-(2-methylphenyl)-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 28925181) has the molecular formula C31H32N2O4S and a molecular weight of 528.67 g/mol. Its IUPAC name is (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-N-(2-methylphenyl)-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-N-(2-methylphenyl)-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 28925181 |
| Molecular Formula | C31H32N2O4S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-N-(2-methylphenyl)-4-(5-methylthiophen-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)Nc2ccccc2C)[C@H]3c2ccc(C)s2)cc1OC |
| InChI | InChI=1S/C31H32N2O4S/c1-17-8-6-7-9-22(17)33-31(35)28-19(3)32-23-14-21(20-11-12-25(36-4)26(16-20)37-5)15-24(34)29(23)30(28)27-13-10-18(2)38-27/h6-13,16,21,30,32H,14-15H2,1-5H3,(H,33,35)/t21-,30+/m0/s1 |
| InChIKey | BDHVEPWHTQRKKY-URAOTHONSA-N |
| XLogP | 6.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |