C36H34N2O6 — CID 1289559
(4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(6-methyl-4-oxochromen-3-yl)-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 1289559) has the molecular formula C36H34N2O6 and a molecular weight of 590.68 g/mol. Its IUPAC name is (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(6-methyl-4-oxochromen-3-yl)-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(6-methyl-4-oxochromen-3-yl)-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 1289559 |
| Molecular Formula | C36H34N2O6 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(6-methyl-4-oxochromen-3-yl)-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)Nc2ccccc2C)[C@H]3c2coc3ccc(C)cc3c2=O)cc1OC |
| InChI | InChI=1S/C36H34N2O6/c1-19-10-12-29-24(14-19)35(40)25(18-44-29)33-32(36(41)38-26-9-7-6-8-20(26)2)21(3)37-27-15-23(16-28(39)34(27)33)22-11-13-30(42-4)31(17-22)43-5/h6-14,17-18,23,33,37H,15-16H2,1-5H3,(H,38,41)/t23-,33+/m0/s1 |
| InChIKey | BQVYVLQDZBLVLO-FLASPHMUSA-N |
| XLogP | 6.43 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |