C32H34N4O6 — CID 102382502
N-(pyridin-2-ylmethyl)-2-[2-[2-[2-[2-(pyridin-2-ylmethylcarbamoyl)phenoxy]ethoxy]ethoxy]ethoxy]benzamide (PubChem CID 102382502) has the molecular formula C32H34N4O6 and a molecular weight of 570.65 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-2-[2-[2-[2-[2-(pyridin-2-ylmethylcarbamoyl)phenoxy]ethoxy]ethoxy]ethoxy]benzamide.
| Compound Name | N-(pyridin-2-ylmethyl)-2-[2-[2-[2-[2-(pyridin-2-ylmethylcarbamoyl)phenoxy]ethoxy]ethoxy]ethoxy]benzamide |
|---|---|
| PubChem CID | 102382502 |
| Molecular Formula | C32H34N4O6 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-2-[2-[2-[2-[2-(pyridin-2-ylmethylcarbamoyl)phenoxy]ethoxy]ethoxy]ethoxy]benzamide |
| SMILES | O=C(NCc1ccccn1)c1ccccc1OCCOCCOCCOc1ccccc1C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C32H34N4O6/c37-31(35-23-25-9-5-7-15-33-25)27-11-1-3-13-29(27)41-21-19-39-17-18-40-20-22-42-30-14-4-2-12-28(30)32(38)36-24-26-10-6-8-16-34-26/h1-16H,17-24H2,(H,35,37)(H,36,38) |
| InChIKey | XTDDCTDTRWSWHY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|