C17H23N7 — CID 102382540
2,6-bis(1-butyltriazol-4-yl)pyridine (PubChem CID 102382540) has the molecular formula C17H23N7 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2,6-bis(1-butyltriazol-4-yl)pyridine.
| Compound Name | 2,6-bis(1-butyltriazol-4-yl)pyridine |
|---|---|
| PubChem CID | 102382540 |
| Molecular Formula | C17H23N7 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2,6-bis(1-butyltriazol-4-yl)pyridine |
| SMILES | CCCCn1cc(-c2cccc(-c3cn(CCCC)nn3)n2)nn1 |
| InChI | InChI=1S/C17H23N7/c1-3-5-10-23-12-16(19-21-23)14-8-7-9-15(18-14)17-13-24(22-20-17)11-6-4-2/h7-9,12-13H,3-6,10-11H2,1-2H3 |
| InChIKey | GAIOUKHWOJVARF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |