C13H19NO5 — CID 102382716
methyl (1R,3R,7aR)-3-tert-butyl-1-methyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 102382716) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl (1R,3R,7aR)-3-tert-butyl-1-methyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (1R,3R,7aR)-3-tert-butyl-1-methyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 102382716 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl (1R,3R,7aR)-3-tert-butyl-1-methyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CC(=O)N1[C@@H](C(C)(C)C)O[C@@H]2C |
| InChI | InChI=1S/C13H19NO5/c1-7-13(11(17)18-5)8(15)6-9(16)14(13)10(19-7)12(2,3)4/h7,10H,6H2,1-5H3/t7-,10-,13-/m1/s1 |
| InChIKey | LIQXOFCNFXQZBZ-XBURVNOZSA-N |
| XLogP | 0.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|