C15H23NO6 — CID 10969020
6-O-ethyl 7a-O-methyl (3S,6R,7aR)-3-tert-butyl-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate (PubChem CID 10969020) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is 6-O-ethyl 7a-O-methyl (3S,6R,7aR)-3-tert-butyl-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate.
| Compound Name | 6-O-ethyl 7a-O-methyl (3S,6R,7aR)-3-tert-butyl-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate |
|---|---|
| PubChem CID | 10969020 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-O-ethyl 7a-O-methyl (3S,6R,7aR)-3-tert-butyl-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@]2(C(=O)OC)CO[C@@H](C(C)(C)C)N2C1=O |
| InChI | InChI=1S/C15H23NO6/c1-6-21-11(18)9-7-15(13(19)20-5)8-22-12(14(2,3)4)16(15)10(9)17/h9,12H,6-8H2,1-5H3/t9-,12+,15-/m1/s1 |
| InChIKey | HBBYYMRRIMLXFY-MURWCNHISA-N |
| XLogP | 0.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|