C14H21NO6 — CID 11833469
(3S,6R,7aR)-3-tert-butyl-7a-methoxycarbonyl-6-methyl-5-oxo-3,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid (PubChem CID 11833469) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is (3S,6R,7aR)-3-tert-butyl-7a-methoxycarbonyl-6-methyl-5-oxo-3,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid.
| Compound Name | (3S,6R,7aR)-3-tert-butyl-7a-methoxycarbonyl-6-methyl-5-oxo-3,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 11833469 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (3S,6R,7aR)-3-tert-butyl-7a-methoxycarbonyl-6-methyl-5-oxo-3,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid |
| SMILES | COC(=O)[C@@]12CO[C@@H](C(C)(C)C)N1C(=O)[C@](C)(C(=O)O)C2 |
| InChI | InChI=1S/C14H21NO6/c1-12(2,3)9-15-8(16)13(4,10(17)18)6-14(15,7-21-9)11(19)20-5/h9H,6-7H2,1-5H3,(H,17,18)/t9-,13+,14+/m0/s1 |
| InChIKey | ZXWSZTABOPMPBU-CUOATXAZSA-N |
| XLogP | 0.62 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|