C16H26N2O7 — CID 139193482
methyl (3R,6S,7S,7aR)-3-tert-butyl-7-methoxy-6-[methoxy(methyl)carbamoyl]-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 139193482) has the molecular formula C16H26N2O7 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl (3R,6S,7S,7aR)-3-tert-butyl-7-methoxy-6-[methoxy(methyl)carbamoyl]-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3R,6S,7S,7aR)-3-tert-butyl-7-methoxy-6-[methoxy(methyl)carbamoyl]-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 139193482 |
| Molecular Formula | C16H26N2O7 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | methyl (3R,6S,7S,7aR)-3-tert-butyl-7-methoxy-6-[methoxy(methyl)carbamoyl]-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)[C@@H](C(=O)N(C)OC)[C@@H]2OC |
| InChI | InChI=1S/C16H26N2O7/c1-15(2,3)13-18-12(20)9(11(19)17(4)24-7)10(22-5)16(18,8-25-13)14(21)23-6/h9-10,13H,8H2,1-7H3/t9-,10+,13-,16-/m1/s1 |
| InChIKey | NHQMKCOVEZBTPH-HMVGFALLSA-N |
| XLogP | -0.21 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|