C25H34N4O2 — CID 102383015
(2S)-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-3,3-dimethyl-2-(pyridin-2-ylmethylideneamino)butanamide (PubChem CID 102383015) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-3,3-dimethyl-2-(pyridin-2-ylmethylideneamino)butanamide.
| Compound Name | (2S)-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-3,3-dimethyl-2-(pyridin-2-ylmethylideneamino)butanamide |
|---|---|
| PubChem CID | 102383015 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (2S)-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-3,3-dimethyl-2-(pyridin-2-ylmethylideneamino)butanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](/N=C/c1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C25H34N4O2/c1-5-6-15-27-23(30)21(17-19-12-8-7-9-13-19)29-24(31)22(25(2,3)4)28-18-20-14-10-11-16-26-20/h7-14,16,18,21-22H,5-6,15,17H2,1-4H3,(H,27,30)(H,29,31)/b28-18+/t21-,22+/m0/s1 |
| InChIKey | XQGGDMVWUOLFSC-OGYKJAPHSA-N |
| XLogP | 3.56 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|