C28H40N4O3 — CID 101106441
(2S)-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-3,3-dimethyl-2-[(6-propan-2-yloxy-2-pyridinyl)methylideneamino]butanamide (PubChem CID 101106441) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-3,3-dimethyl-2-[(6-propan-2-yloxy-2-pyridinyl)methylideneamino]butanamide.
| Compound Name | (2S)-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-3,3-dimethyl-2-[(6-propan-2-yloxy-2-pyridinyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 101106441 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (2S)-N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-3,3-dimethyl-2-[(6-propan-2-yloxy-2-pyridinyl)methylideneamino]butanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](/N=C/c1cccc(OC(C)C)n1)C(C)(C)C |
| InChI | InChI=1S/C28H40N4O3/c1-7-8-17-29-26(33)23(18-21-13-10-9-11-14-21)32-27(34)25(28(4,5)6)30-19-22-15-12-16-24(31-22)35-20(2)3/h9-16,19-20,23,25H,7-8,17-18H2,1-6H3,(H,29,33)(H,32,34)/b30-19+/t23-,25+/m0/s1 |
| InChIKey | SNIPWGMGPIOJPD-CWLRUKEYSA-N |
| XLogP | 4.35 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|