C11H17NOSi — CID 102383726
1-[dimethyl(phenyl)silyl]-N,N-dimethylformamide (PubChem CID 102383726) has the molecular formula C11H17NOSi and a molecular weight of 207.35 g/mol. Its IUPAC name is 1-[dimethyl(phenyl)silyl]-N,N-dimethylformamide.
| Compound Name | 1-[dimethyl(phenyl)silyl]-N,N-dimethylformamide |
|---|---|
| PubChem CID | 102383726 |
| Molecular Formula | C11H17NOSi |
| Molecular Weight | 207.35 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 1-[dimethyl(phenyl)silyl]-N,N-dimethylformamide |
| SMILES | CN(C)C(=O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C11H17NOSi/c1-12(2)11(13)14(3,4)10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | UMLUFOOYCAMCHS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|