C26H23F3NO2P — CID 102386708
N-diphenylphosphoryl-1-ethoxy-2,2,2-trifluoro-1-naphthalen-2-ylethanamine (PubChem CID 102386708) has the molecular formula C26H23F3NO2P and a molecular weight of 469.44 g/mol. Its IUPAC name is N-diphenylphosphoryl-1-ethoxy-2,2,2-trifluoro-1-naphthalen-2-ylethanamine.
| Compound Name | N-diphenylphosphoryl-1-ethoxy-2,2,2-trifluoro-1-naphthalen-2-ylethanamine |
|---|---|
| PubChem CID | 102386708 |
| Molecular Formula | C26H23F3NO2P |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-diphenylphosphoryl-1-ethoxy-2,2,2-trifluoro-1-naphthalen-2-ylethanamine |
| SMILES | CCOC(NP(=O)(c1ccccc1)c1ccccc1)(c1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C26H23F3NO2P/c1-2-32-25(26(27,28)29,22-18-17-20-11-9-10-12-21(20)19-22)30-33(31,23-13-5-3-6-14-23)24-15-7-4-8-16-24/h3-19H,2H2,1H3,(H,30,31) |
| InChIKey | YETZQIXHNQAQIY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|