C19H22N2O4 — CID 102387247
[2,6-dimethoxy-4-(1-methylpyrrolidin-2-yl)phenyl] pyridine-4-carboxylate (PubChem CID 102387247) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is [2,6-dimethoxy-4-(1-methylpyrrolidin-2-yl)phenyl] pyridine-4-carboxylate.
| Compound Name | [2,6-dimethoxy-4-(1-methylpyrrolidin-2-yl)phenyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 102387247 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [2,6-dimethoxy-4-(1-methylpyrrolidin-2-yl)phenyl] pyridine-4-carboxylate |
| SMILES | COc1cc(C2CCCN2C)cc(OC)c1OC(=O)c1ccncc1 |
| InChI | InChI=1S/C19H22N2O4/c1-21-10-4-5-15(21)14-11-16(23-2)18(17(12-14)24-3)25-19(22)13-6-8-20-9-7-13/h6-9,11-12,15H,4-5,10H2,1-3H3 |
| InChIKey | CGNWYHGYFNIOET-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|